About [1,3]thiazolo[5,4-e][2,1]benzoxazole
[1,3]thiazolo[5,4-e][2,1]benzoxazole (PubChem CID 57349206) has the molecular formula C8H4N2OS
and a molecular weight of 176.20 g/mol. Its IUPAC name is [1,3]thiazolo[5,4-e][2,1]benzoxazole.
Molecular Properties
| Compound Name | [1,3]thiazolo[5,4-e][2,1]benzoxazole |
| PubChem CID | 57349206 |
| Molecular Formula | C8H4N2OS |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | [1,3]thiazolo[5,4-e][2,1]benzoxazole |
| SMILES | c1nc2ccc3nocc3c2s1 |
| InChI | InChI=1S/C8H4N2OS/c1-2-7-8(12-4-9-7)5-3-11-10-6(1)5/h1-4H |
| InChIKey | ZCIOWBQROPJUIG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]thiazolo[5,4-e][2,1]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]thiazolo[5,4-e][2,1]benzoxazole?
The IUPAC name of [1,3]thiazolo[5,4-e][2,1]benzoxazole (CID 57349206) is [1,3]thiazolo[5,4-e][2,1]benzoxazole.
What is the SMILES notation for [1,3]thiazolo[5,4-e][2,1]benzoxazole?
The canonical SMILES for [1,3]thiazolo[5,4-e][2,1]benzoxazole is c1nc2ccc3nocc3c2s1.
What is the InChIKey of [1,3]thiazolo[5,4-e][2,1]benzoxazole?
The InChIKey is ZCIOWBQROPJUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2OS/c1-2-7-8(12-4-9-7)5-3-11-10-6(1)5/h1-4H.
What are the key properties of [1,3]thiazolo[5,4-e][2,1]benzoxazole?
[1,3]thiazolo[5,4-e][2,1]benzoxazole has a molecular weight of 176.20 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]thiazolo[5,4-e][2,1]benzoxazole is sourced from PubChem (CID 57349206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).