About 5-Iodo-2-thiouracil monosodium salt
5-Iodo-2-thiouracil monosodium salt (PubChem CID 57349231) has the molecular formula C4H3IN2NaOS
and a molecular weight of 277.04 g/mol.
Molecular Properties
| Compound Name | 5-Iodo-2-thiouracil monosodium salt |
| PubChem CID | 57349231 |
| Molecular Formula | C4H3IN2NaOS |
| Molecular Weight | 277.04 g/mol |
| Exact Mass | 276.89 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=S)[nH]cc1I.[Na] |
| InChI | InChI=1S/C4H3IN2OS.Na/c5-2-1-6-4(9)7-3(2)8;/h1H,(H2,6,7,8,9); |
| InChIKey | PHTWQNPBVZJXOQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.04 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-Iodo-2-thiouracil monosodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-Iodo-2-thiouracil monosodium salt?
The IUPAC name of 5-Iodo-2-thiouracil monosodium salt (CID 57349231) is not available.
What is the SMILES notation for 5-Iodo-2-thiouracil monosodium salt?
The canonical SMILES for 5-Iodo-2-thiouracil monosodium salt is O=c1[nH]c(=S)[nH]cc1I.[Na].
What is the InChIKey of 5-Iodo-2-thiouracil monosodium salt?
The InChIKey is PHTWQNPBVZJXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3IN2OS.Na/c5-2-1-6-4(9)7-3(2)8;/h1H,(H2,6,7,8,9);.
What are the key properties of 5-Iodo-2-thiouracil monosodium salt?
5-Iodo-2-thiouracil monosodium salt has a molecular weight of 277.04 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-Iodo-2-thiouracil monosodium salt is sourced from PubChem (CID 57349231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).