C34H30N8Na2O10S2 — CID 57349571
disodium;5,5-bis[(4-methoxy-6-phenoxy-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate (PubChem CID 57349571) has the molecular formula C34H30N8Na2O10S2 and a molecular weight of 820.77 g/mol. Its IUPAC name is disodium;5,5-bis[(4-methoxy-6-phenoxy-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate.
| Compound Name | disodium;5,5-bis[(4-methoxy-6-phenoxy-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate |
|---|---|
| PubChem CID | 57349571 |
| Molecular Formula | C34H30N8Na2O10S2 |
| Molecular Weight | 820.77 g/mol |
| Exact Mass | 820.13 |
| IUPAC Name | disodium;5,5-bis[(4-methoxy-6-phenoxy-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate |
| SMILES | COc1nc(NC2(Nc3nc(OC)nc(Oc4ccccc4)n3)C=CC(C=Cc3ccccc3)C(S(=O)(=O)[O-])(S(=O)(=O)[O-])C2)nc(Oc2ccccc2)n1.[Na+].[Na+] |
| InChI | InChI=1S/C34H32N8O10S2.2Na/c1-49-29-35-27(37-31(39-29)51-25-14-8-4-9-15-25)41-33(42-28-36-30(50-2)40-32(38-28)52-26-16-10-5-11-17-26)21-20-24(19-18-23-12-6-3-7-13-23)34(22-33,53(43,44)45)54(46,47)48;;/h3-21,24H,22H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,35,37,39,41)(H,36,38,40,42);;/q;2*+1/p-2 |
| InChIKey | RMSGTBCFPOZIGZ-UHFFFAOYSA-L |
| XLogP | -2.04 |
| TPSA | 252.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.77 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|