C13H14N2 — CID 57349669
1,2,3,4-tetrahydrobenzo[h]isoquinolin-6-amine (PubChem CID 57349669) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrobenzo[h]isoquinolin-6-amine.
| Compound Name | 1,2,3,4-tetrahydrobenzo[h]isoquinolin-6-amine |
|---|---|
| PubChem CID | 57349669 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1,2,3,4-tetrahydrobenzo[h]isoquinolin-6-amine |
| SMILES | Nc1cc2c(c3ccccc13)CNCC2 |
| InChI | InChI=1S/C13H14N2/c14-13-7-9-5-6-15-8-12(9)10-3-1-2-4-11(10)13/h1-4,7,15H,5-6,8,14H2 |
| InChIKey | ZYINBLHJLKGWKQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|