C13H14F6N3O3S- — CID 57350204
2-[2-[[1,1,1,3,3,3-hexafluoro-2-(propanoylamino)propan-2-yl]amino]-1,3-thiazol-5-yl]butanoate (PubChem CID 57350204) has the molecular formula C13H14F6N3O3S- and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-[2-[[1,1,1,3,3,3-hexafluoro-2-(propanoylamino)propan-2-yl]amino]-1,3-thiazol-5-yl]butanoate.
| Compound Name | 2-[2-[[1,1,1,3,3,3-hexafluoro-2-(propanoylamino)propan-2-yl]amino]-1,3-thiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 57350204 |
| Molecular Formula | C13H14F6N3O3S- |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-[2-[[1,1,1,3,3,3-hexafluoro-2-(propanoylamino)propan-2-yl]amino]-1,3-thiazol-5-yl]butanoate |
| SMILES | CCC(=O)NC(Nc1ncc(C(CC)C(=O)[O-])s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H15F6N3O3S/c1-3-6(9(24)25)7-5-20-10(26-7)22-11(12(14,15)16,13(17,18)19)21-8(23)4-2/h5-6H,3-4H2,1-2H3,(H,20,22)(H,21,23)(H,24,25)/p-1 |
| InChIKey | FYGORDZGWYBCJI-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|