C8H9N2O3S- — CID 57350320
2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanoate (PubChem CID 57350320) has the molecular formula C8H9N2O3S- and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanoate.
| Compound Name | 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 57350320 |
| Molecular Formula | C8H9N2O3S- |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanoate |
| SMILES | CCC(Sc1nccc(=O)[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C8H10N2O3S/c1-2-5(7(12)13)14-8-9-4-3-6(11)10-8/h3-5H,2H2,1H3,(H,12,13)(H,9,10,11)/p-1 |
| InChIKey | YCLFLKAVOHILMD-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |