C24H19Cl2NO4 — CID 57350343
(2R)-2-[amino-(2,4-dichlorophenyl)methyl]-3-(9H-fluoren-9-ylmethoxy)-3-oxopropanoic acid (PubChem CID 57350343) has the molecular formula C24H19Cl2NO4 and a molecular weight of 456.33 g/mol. Its IUPAC name is (2R)-2-[amino-(2,4-dichlorophenyl)methyl]-3-(9H-fluoren-9-ylmethoxy)-3-oxopropanoic acid.
| Compound Name | (2R)-2-[amino-(2,4-dichlorophenyl)methyl]-3-(9H-fluoren-9-ylmethoxy)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 57350343 |
| Molecular Formula | C24H19Cl2NO4 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (2R)-2-[amino-(2,4-dichlorophenyl)methyl]-3-(9H-fluoren-9-ylmethoxy)-3-oxopropanoic acid |
| SMILES | NC(c1ccc(Cl)cc1Cl)[C@H](C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19Cl2NO4/c25-13-9-10-18(20(26)11-13)22(27)21(23(28)29)24(30)31-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-11,19,21-22H,12,27H2,(H,28,29)/t21-,22?/m1/s1 |
| InChIKey | XQVXJTNLLOVRSX-ZMFCMNQTSA-N |
| XLogP | 5.05 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|