About 4-methylbenzenesulfonate;piperidin-1-ium
4-methylbenzenesulfonate;piperidin-1-ium (PubChem CID 57350464) has the molecular formula C12H19NO3S
and a molecular weight of 257.35 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;piperidin-1-ium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;piperidin-1-ium |
| PubChem CID | 57350464 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-methylbenzenesulfonate;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C5H11N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1/h2-5H,1H3,(H,8,9,10);6H,1-5H2 |
| InChIKey | ZHBMGKRWRNEMOQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;piperidin-1-ium?
The IUPAC name of 4-methylbenzenesulfonate;piperidin-1-ium (CID 57350464) is 4-methylbenzenesulfonate;piperidin-1-ium.
What is the SMILES notation for 4-methylbenzenesulfonate;piperidin-1-ium?
The canonical SMILES for 4-methylbenzenesulfonate;piperidin-1-ium is C1CC[NH2+]CC1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;piperidin-1-ium?
The InChIKey is ZHBMGKRWRNEMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C5H11N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1/h2-5H,1H3,(H,8,9,10);6H,1-5H2.
What are the key properties of 4-methylbenzenesulfonate;piperidin-1-ium?
4-methylbenzenesulfonate;piperidin-1-ium has a molecular weight of 257.35 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;piperidin-1-ium is sourced from PubChem (CID 57350464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).