C19H21Cl3O3 — CID 57350755
4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(2,4,5-trichlorophenoxy)butanoic acid (PubChem CID 57350755) has the molecular formula C19H21Cl3O3 and a molecular weight of 403.73 g/mol. Its IUPAC name is 4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(2,4,5-trichlorophenoxy)butanoic acid.
| Compound Name | 4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(2,4,5-trichlorophenoxy)butanoic acid |
|---|---|
| PubChem CID | 57350755 |
| Molecular Formula | C19H21Cl3O3 |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(2,4,5-trichlorophenoxy)butanoic acid |
| SMILES | CC1(C)C2CC=C(CCC(Oc3cc(Cl)c(Cl)cc3Cl)C(=O)O)C1C2 |
| InChI | InChI=1S/C19H21Cl3O3/c1-19(2)11-5-3-10(12(19)7-11)4-6-16(18(23)24)25-17-9-14(21)13(20)8-15(17)22/h3,8-9,11-12,16H,4-7H2,1-2H3,(H,23,24) |
| InChIKey | FNBNZNDAUCHYAS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|