About 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine
1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 57350810) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 57350810 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCC(C)n1ncc2c(N)ncnc21 |
| InChI | InChI=1S/C11H17N5/c1-3-4-5-8(2)16-11-9(6-15-16)10(12)13-7-14-11/h6-8H,3-5H2,1-2H3,(H2,12,13,14) |
| InChIKey | BVFULRFPWIGJLN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CID 57350810) is 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine is CCCCC(C)n1ncc2c(N)ncnc21.
What is the InChIKey of 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is BVFULRFPWIGJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5/c1-3-4-5-8(2)16-11-9(6-15-16)10(12)13-7-14-11/h6-8H,3-5H2,1-2H3,(H2,12,13,14).
What are the key properties of 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 219.29 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 57350810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).