C18H22N6 — CID 57351097
4-[(2,4-dimethyl-3H-1,2,4-triazol-3-yl)diazenyl]-N-(2-phenylethyl)aniline (PubChem CID 57351097) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-3H-1,2,4-triazol-3-yl)diazenyl]-N-(2-phenylethyl)aniline.
| Compound Name | 4-[(2,4-dimethyl-3H-1,2,4-triazol-3-yl)diazenyl]-N-(2-phenylethyl)aniline |
|---|---|
| PubChem CID | 57351097 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[(2,4-dimethyl-3H-1,2,4-triazol-3-yl)diazenyl]-N-(2-phenylethyl)aniline |
| SMILES | CN1C=NN(C)C1/N=N/c1ccc(NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N6/c1-23-14-20-24(2)18(23)22-21-17-10-8-16(9-11-17)19-13-12-15-6-4-3-5-7-15/h3-11,14,18-19H,12-13H2,1-2H3/b22-21+ |
| InChIKey | USZYVLADXAFZMH-QURGRASLSA-N |
| XLogP | 3.53 |
| TPSA | 55.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|