C5H20O5Si5 — CID 57351549
2,2,4,4,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 57351549) has the molecular formula C5H20O5Si5 and a molecular weight of 300.64 g/mol. Its IUPAC name is 2,2,4,4,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,4,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 57351549 |
| Molecular Formula | C5H20O5Si5 |
| Molecular Weight | 300.64 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2,2,4,4,6-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C[SiH]1O[SiH2]O[SiH2]O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C5H20O5Si5/c1-13-7-11-6-12-8-14(2,3)10-15(4,5)9-13/h13H,11-12H2,1-5H3 |
| InChIKey | BFLLZZNUSYQLEY-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.64 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|