2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride

C6H13ClN2O — CID 57351560

IUPAC2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride
SMILESCN1C=C[NH+](CCO)C1.[Cl-]
InChIInChI=1S/C6H12N2O.ClH/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H
InChIKeyYZFODOULAHZZHX-UHFFFAOYSA-N
MW164.64 g/mol
LogP-4.76
Rot. Bonds2

About 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride

2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride (PubChem CID 57351560) has the molecular formula C6H13ClN2O and a molecular weight of 164.64 g/mol. Its IUPAC name is 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride.

Molecular Properties

Compound Name2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride
PubChem CID57351560
Molecular FormulaC6H13ClN2O
Molecular Weight164.64 g/mol
Exact Mass164.07
IUPAC Name2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride
SMILESCN1C=C[NH+](CCO)C1.[Cl-]
InChIInChI=1S/C6H12N2O.ClH/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H
InChIKeyYZFODOULAHZZHX-UHFFFAOYSA-N
XLogP-4.76
TPSA27.91 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.64
LogP ≤ 5-4.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride?
The IUPAC name of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride (CID 57351560) is 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride.
What is the SMILES notation for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride?
The canonical SMILES for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride is CN1C=C[NH+](CCO)C1.[Cl-].
What is the InChIKey of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride?
The InChIKey is YZFODOULAHZZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.ClH/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H.
What are the key properties of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride?
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride has a molecular weight of 164.64 g/mol, XLogP of -4.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride is sourced from PubChem (CID 57351560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).