C26H29N3 — CID 57351566
2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-N,N,1-trimethyl-2H-quinolin-6-amine (PubChem CID 57351566) has the molecular formula C26H29N3 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-N,N,1-trimethyl-2H-quinolin-6-amine.
| Compound Name | 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-N,N,1-trimethyl-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 57351566 |
| Molecular Formula | C26H29N3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-N,N,1-trimethyl-2H-quinolin-6-amine |
| SMILES | Cc1cc(C=CC2C=Cc3cc(N(C)C)ccc3N2C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C26H29N3/c1-19-17-21(20(2)29(19)24-9-7-6-8-10-24)11-13-23-14-12-22-18-25(27(3)4)15-16-26(22)28(23)5/h6-18,23H,1-5H3 |
| InChIKey | VPKCTQVIBYHCBP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|