About 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide
6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide (PubChem CID 573518) has the molecular formula C10H9F3O2S
and a molecular weight of 250.24 g/mol. Its IUPAC name is 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide.
Molecular Properties
| Compound Name | 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide |
| PubChem CID | 573518 |
| Molecular Formula | C10H9F3O2S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide |
| SMILES | Cc1ccc2c(c1)S(=O)C(C(F)(F)F)CO2 |
| InChI | InChI=1S/C10H9F3O2S/c1-6-2-3-7-8(4-6)16(14)9(5-15-7)10(11,12)13/h2-4,9H,5H2,1H3 |
| InChIKey | POGQZLJHUILGHT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide?
The IUPAC name of 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide (CID 573518) is 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide.
What is the SMILES notation for 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide?
The canonical SMILES for 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide is Cc1ccc2c(c1)S(=O)C(C(F)(F)F)CO2.
What is the InChIKey of 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide?
The InChIKey is POGQZLJHUILGHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O2S/c1-6-2-3-7-8(4-6)16(14)9(5-15-7)10(11,12)13/h2-4,9H,5H2,1H3.
What are the key properties of 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide?
6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide has a molecular weight of 250.24 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(trifluoromethyl)-2,3-dihydro-1,4lambda4-benzoxathiine 4-oxide is sourced from PubChem (CID 573518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).