About 1-anilino-1-methylurea
1-anilino-1-methylurea (PubChem CID 57352183) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 1-anilino-1-methylurea.
Molecular Properties
| Compound Name | 1-anilino-1-methylurea |
| PubChem CID | 57352183 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-anilino-1-methylurea |
| SMILES | CN(Nc1ccccc1)C(N)=O |
| InChI | InChI=1S/C8H11N3O/c1-11(8(9)12)10-7-5-3-2-4-6-7/h2-6,10H,1H3,(H2,9,12) |
| InChIKey | NWJIYBQHRFFCOY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilino-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-1-methylurea?
The IUPAC name of 1-anilino-1-methylurea (CID 57352183) is 1-anilino-1-methylurea.
What is the SMILES notation for 1-anilino-1-methylurea?
The canonical SMILES for 1-anilino-1-methylurea is CN(Nc1ccccc1)C(N)=O.
What is the InChIKey of 1-anilino-1-methylurea?
The InChIKey is NWJIYBQHRFFCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-11(8(9)12)10-7-5-3-2-4-6-7/h2-6,10H,1H3,(H2,9,12).
What are the key properties of 1-anilino-1-methylurea?
1-anilino-1-methylurea has a molecular weight of 165.20 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-1-methylurea is sourced from PubChem (CID 57352183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).