About 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine
2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine (PubChem CID 57352300) has the molecular formula C13H28N8
and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine |
| PubChem CID | 57352300 |
| Molecular Formula | C13H28N8 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine |
| SMILES | CCCC/N=C(\N)NN=CC(C)=NN/C(N)=N/CCCC |
| InChI | InChI=1S/C13H28N8/c1-4-6-8-16-12(14)20-18-10-11(3)19-21-13(15)17-9-7-5-2/h10H,4-9H2,1-3H3,(H3,14,16,20)(H3,15,17,21) |
| InChIKey | DCVQOLOVXUUDBR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine?
The IUPAC name of 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine (CID 57352300) is 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine.
What is the SMILES notation for 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine?
The canonical SMILES for 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine is CCCC/N=C(\N)NN=CC(C)=NN/C(N)=N/CCCC.
What is the InChIKey of 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine?
The InChIKey is DCVQOLOVXUUDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N8/c1-4-6-8-16-12(14)20-18-10-11(3)19-21-13(15)17-9-7-5-2/h10H,4-9H2,1-3H3,(H3,14,16,20)(H3,15,17,21).
What are the key properties of 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine?
2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine has a molecular weight of 296.42 g/mol, XLogP of 0.76, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-[1-[(N'-butylcarbamimidoyl)hydrazinylidene]propan-2-ylideneamino]guanidine is sourced from PubChem (CID 57352300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).