About 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate
2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate (PubChem CID 57352459) has the molecular formula C14H23N5O
and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate.
Molecular Properties
| Compound Name | 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate |
| PubChem CID | 57352459 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate |
| SMILES | CC(C)(C)C(C)(C)N(/C(N)=N/C#N)c1ccncc1.O |
| InChI | InChI=1S/C14H21N5.H2O/c1-13(2,3)14(4,5)19(12(16)18-10-15)11-6-8-17-9-7-11;/h6-9H,1-5H3,(H2,16,18);1H2 |
| InChIKey | PJXPEAGZEYFNHA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate?
The IUPAC name of 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate (CID 57352459) is 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate.
What is the SMILES notation for 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate?
The canonical SMILES for 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate is CC(C)(C)C(C)(C)N(/C(N)=N/C#N)c1ccncc1.O.
What is the InChIKey of 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate?
The InChIKey is PJXPEAGZEYFNHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5.H2O/c1-13(2,3)14(4,5)19(12(16)18-10-15)11-6-8-17-9-7-11;/h6-9H,1-5H3,(H2,16,18);1H2.
What are the key properties of 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate?
2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate has a molecular weight of 277.37 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-1-pyridin-4-yl-1-(2,3,3-trimethylbutan-2-yl)guanidine;hydrate is sourced from PubChem (CID 57352459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).