About (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol
(6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol (PubChem CID 57352521) has the molecular formula C7H6ClN3O
and a molecular weight of 183.60 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol.
Molecular Properties
| Compound Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol |
| PubChem CID | 57352521 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol |
| SMILES | OCc1cnc2ccc(Cl)nn12 |
| InChI | InChI=1S/C7H6ClN3O/c8-6-1-2-7-9-3-5(4-12)11(7)10-6/h1-3,12H,4H2 |
| InChIKey | VZFRNQCOHYEZFL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol?
The IUPAC name of (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol (CID 57352521) is (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol.
What is the SMILES notation for (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol?
The canonical SMILES for (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol is OCc1cnc2ccc(Cl)nn12.
What is the InChIKey of (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol?
The InChIKey is VZFRNQCOHYEZFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O/c8-6-1-2-7-9-3-5(4-12)11(7)10-6/h1-3,12H,4H2.
What are the key properties of (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol?
(6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol has a molecular weight of 183.60 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloroimidazo[1,2-b]pyridazin-3-yl)methanol is sourced from PubChem (CID 57352521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).