C13H8F13NO5S2 — CID 57352625
(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)methyl benzenesulfonate (PubChem CID 57352625) has the molecular formula C13H8F13NO5S2 and a molecular weight of 569.32 g/mol. Its IUPAC name is (1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)methyl benzenesulfonate.
| Compound Name | (1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)methyl benzenesulfonate |
|---|---|
| PubChem CID | 57352625 |
| Molecular Formula | C13H8F13NO5S2 |
| Molecular Weight | 569.32 g/mol |
| Exact Mass | 568.96 |
| IUPAC Name | (1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)methyl benzenesulfonate |
| SMILES | O=S(=O)(OCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H8F13NO5S2/c14-8(15,10(18,19)12(22,23)24)9(16,17)11(20,21)13(25,26)34(30,31)27-6-32-33(28,29)7-4-2-1-3-5-7/h1-5,27H,6H2 |
| InChIKey | QCQCNZBNLCELHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|