C8H14IN2- — CID 57353429
N,N,1-trimethyl-2H-pyridin-4-amine iodide (PubChem CID 57353429) has the molecular formula C8H14IN2- and a molecular weight of 265.12 g/mol. Its IUPAC name is N,N,1-trimethyl-2H-pyridin-4-amine iodide.
| Compound Name | N,N,1-trimethyl-2H-pyridin-4-amine iodide |
|---|---|
| PubChem CID | 57353429 |
| Molecular Formula | C8H14IN2- |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | N,N,1-trimethyl-2H-pyridin-4-amine iodide |
| SMILES | CN1C=CC(N(C)C)=CC1.[I-] |
| InChI | InChI=1S/C8H14N2.HI/c1-9(2)8-4-6-10(3)7-5-8;/h4-6H,7H2,1-3H3;1H/p-1 |
| InChIKey | BTYGAEQLRCPZPC-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|