About benzo[a]fluoren-1-one
benzo[a]fluoren-1-one (PubChem CID 57353479) has the molecular formula C17H10O
and a molecular weight of 230.27 g/mol. Its IUPAC name is benzo[a]fluoren-1-one.
Molecular Properties
| Compound Name | benzo[a]fluoren-1-one |
| PubChem CID | 57353479 |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | benzo[a]fluoren-1-one |
| SMILES | O=C1C=CC=c2ccc3c(c21)C=c1ccccc1=3 |
| InChI | InChI=1S/C17H10O/c18-16-7-3-5-11-8-9-14-13-6-2-1-4-12(13)10-15(14)17(11)16/h1-10H |
| InChIKey | WVXMLBXFHITUIT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[a]fluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]fluoren-1-one?
The IUPAC name of benzo[a]fluoren-1-one (CID 57353479) is benzo[a]fluoren-1-one.
What is the SMILES notation for benzo[a]fluoren-1-one?
The canonical SMILES for benzo[a]fluoren-1-one is O=C1C=CC=c2ccc3c(c21)C=c1ccccc1=3.
What is the InChIKey of benzo[a]fluoren-1-one?
The InChIKey is WVXMLBXFHITUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O/c18-16-7-3-5-11-8-9-14-13-6-2-1-4-12(13)10-15(14)17(11)16/h1-10H.
What are the key properties of benzo[a]fluoren-1-one?
benzo[a]fluoren-1-one has a molecular weight of 230.27 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]fluoren-1-one is sourced from PubChem (CID 57353479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).