C34H34N2O5 — CID 57353814
2,3,4,12,13-pentamethoxy-6-(4-phenylphenyl)-6,7,9,10-tetrahydroisoquinolino[2,1-d][1,4]benzodiazepine (PubChem CID 57353814) has the molecular formula C34H34N2O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2,3,4,12,13-pentamethoxy-6-(4-phenylphenyl)-6,7,9,10-tetrahydroisoquinolino[2,1-d][1,4]benzodiazepine.
| Compound Name | 2,3,4,12,13-pentamethoxy-6-(4-phenylphenyl)-6,7,9,10-tetrahydroisoquinolino[2,1-d][1,4]benzodiazepine |
|---|---|
| PubChem CID | 57353814 |
| Molecular Formula | C34H34N2O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 2,3,4,12,13-pentamethoxy-6-(4-phenylphenyl)-6,7,9,10-tetrahydroisoquinolino[2,1-d][1,4]benzodiazepine |
| SMILES | COc1cc2c(cc1OC)C1=c3cc(OC)c(OC)c(OC)c3=NC(c3ccc(-c4ccccc4)cc3)CN1CC2 |
| InChI | InChI=1S/C34H34N2O5/c1-37-28-17-24-15-16-36-20-27(23-13-11-22(12-14-23)21-9-7-6-8-10-21)35-31-26(32(36)25(24)18-29(28)38-2)19-30(39-3)33(40-4)34(31)41-5/h6-14,17-19,27H,15-16,20H2,1-5H3 |
| InChIKey | OGVJKVCLHAJHPT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |