About CID 57354386
CID 57354386 (PubChem CID 57354386) has the molecular formula C9H19NNaO2
and a molecular weight of 196.25 g/mol.
Molecular Properties
| Compound Name | CID 57354386 |
| PubChem CID | 57354386 |
| Molecular Formula | C9H19NNaO2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | — |
| SMILES | CC(C)CCCCCC(=O)NO.[Na] |
| InChI | InChI=1S/C9H19NO2.Na/c1-8(2)6-4-3-5-7-9(11)10-12;/h8,12H,3-7H2,1-2H3,(H,10,11); |
| InChIKey | MPVCZXIUVZLTDG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 57354386 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57354386?
The IUPAC name of CID 57354386 (CID 57354386) is not available.
What is the SMILES notation for CID 57354386?
The canonical SMILES for CID 57354386 is CC(C)CCCCCC(=O)NO.[Na].
What is the InChIKey of CID 57354386?
The InChIKey is MPVCZXIUVZLTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.Na/c1-8(2)6-4-3-5-7-9(11)10-12;/h8,12H,3-7H2,1-2H3,(H,10,11);.
What are the key properties of CID 57354386?
CID 57354386 has a molecular weight of 196.25 g/mol, XLogP of 1.72, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57354386 is sourced from PubChem (CID 57354386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).