About Hydroxymethyl benzenesulfonate--aluminium (1/1)
Hydroxymethyl benzenesulfonate--aluminium (1/1) (PubChem CID 57354388) has the molecular formula C7H8AlO4S
and a molecular weight of 215.19 g/mol.
Molecular Properties
| Compound Name | Hydroxymethyl benzenesulfonate--aluminium (1/1) |
| PubChem CID | 57354388 |
| Molecular Formula | C7H8AlO4S |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)(OCO)c1ccccc1.[Al] |
| InChI | InChI=1S/C7H8O4S.Al/c8-6-11-12(9,10)7-4-2-1-3-5-7;/h1-5,8H,6H2; |
| InChIKey | SGYRWBWJAKCDRX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze Hydroxymethyl benzenesulfonate--aluminium (1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hydroxymethyl benzenesulfonate--aluminium (1/1)?
The IUPAC name of Hydroxymethyl benzenesulfonate--aluminium (1/1) (CID 57354388) is not available.
What is the SMILES notation for Hydroxymethyl benzenesulfonate--aluminium (1/1)?
The canonical SMILES for Hydroxymethyl benzenesulfonate--aluminium (1/1) is O=S(=O)(OCO)c1ccccc1.[Al].
What is the InChIKey of Hydroxymethyl benzenesulfonate--aluminium (1/1)?
The InChIKey is SGYRWBWJAKCDRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4S.Al/c8-6-11-12(9,10)7-4-2-1-3-5-7;/h1-5,8H,6H2;.
What are the key properties of Hydroxymethyl benzenesulfonate--aluminium (1/1)?
Hydroxymethyl benzenesulfonate--aluminium (1/1) has a molecular weight of 215.19 g/mol, XLogP of -0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Hydroxymethyl benzenesulfonate--aluminium (1/1) is sourced from PubChem (CID 57354388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).