C21H45IO2Si2 — CID 57354457
tert-butyl-[(2S,3R,4S)-6-iodo-2,4-dimethyl-1-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane (PubChem CID 57354457) has the molecular formula C21H45IO2Si2 and a molecular weight of 512.67 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4S)-6-iodo-2,4-dimethyl-1-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4S)-6-iodo-2,4-dimethyl-1-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 57354457 |
| Molecular Formula | C21H45IO2Si2 |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | tert-butyl-[(2S,3R,4S)-6-iodo-2,4-dimethyl-1-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=C(C)I |
| InChI | InChI=1S/C21H45IO2Si2/c1-12-26(13-2,14-3)23-16-18(5)20(17(4)15-19(6)22)24-25(10,11)21(7,8)9/h15,17-18,20H,12-14,16H2,1-11H3/t17-,18-,20+/m0/s1 |
| InChIKey | LCBTUSMUAWDIMB-CMKODMSKSA-N |
| XLogP | 8.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|