C54H54N4O4S — CID 57354566
bis(9-ethyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]carbazole);sulfate (PubChem CID 57354566) has the molecular formula C54H54N4O4S and a molecular weight of 855.12 g/mol. Its IUPAC name is bis(9-ethyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]carbazole);sulfate.
| Compound Name | bis(9-ethyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]carbazole);sulfate |
|---|---|
| PubChem CID | 57354566 |
| Molecular Formula | C54H54N4O4S |
| Molecular Weight | 855.12 g/mol |
| Exact Mass | 854.39 |
| IUPAC Name | bis(9-ethyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]carbazole);sulfate |
| SMILES | CCn1c2ccccc2c2cc(C=CC3=[N+](C)c4ccccc4C3(C)C)ccc21.CCn1c2ccccc2c2cc(C=CC3=[N+](C)c4ccccc4C3(C)C)ccc21.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C27H27N2.H2O4S/c2*1-5-29-23-12-8-6-10-20(23)21-18-19(14-16-24(21)29)15-17-26-27(2,3)22-11-7-9-13-25(22)28(26)4;1-5(2,3)4/h2*6-18H,5H2,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | RSWMCMBZUDHZRB-UHFFFAOYSA-L |
| XLogP | 11.73 |
| TPSA | 96.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.12 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|