About 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal
3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal (PubChem CID 57355112) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal.
Molecular Properties
| Compound Name | 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal |
| PubChem CID | 57355112 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal |
| SMILES | COC1(CCC=O)C=CC(=O)C=C1 |
| InChI | InChI=1S/C10H12O3/c1-13-10(5-2-8-11)6-3-9(12)4-7-10/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | QSMLXFHNKKKKGN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal?
The IUPAC name of 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal (CID 57355112) is 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal.
What is the SMILES notation for 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal?
The canonical SMILES for 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal is COC1(CCC=O)C=CC(=O)C=C1.
What is the InChIKey of 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal?
The InChIKey is QSMLXFHNKKKKGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-13-10(5-2-8-11)6-3-9(12)4-7-10/h3-4,6-8H,2,5H2,1H3.
What are the key properties of 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal?
3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal has a molecular weight of 180.20 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanal is sourced from PubChem (CID 57355112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).