About 3H-naphtho[2,3-e]indazole
3H-naphtho[2,3-e]indazole (PubChem CID 57355763) has the molecular formula C15H10N2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3H-naphtho[2,3-e]indazole.
Molecular Properties
| Compound Name | 3H-naphtho[2,3-e]indazole |
| PubChem CID | 57355763 |
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3H-naphtho[2,3-e]indazole |
| SMILES | c1ccc2cc3c(ccc4[nH]ncc43)cc2c1 |
| InChI | InChI=1S/C15H10N2/c1-2-4-11-8-13-12(7-10(11)3-1)5-6-15-14(13)9-16-17-15/h1-9H,(H,16,17) |
| InChIKey | BTQAFTBKHVLPEV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3H-naphtho[2,3-e]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-naphtho[2,3-e]indazole?
The IUPAC name of 3H-naphtho[2,3-e]indazole (CID 57355763) is 3H-naphtho[2,3-e]indazole.
What is the SMILES notation for 3H-naphtho[2,3-e]indazole?
The canonical SMILES for 3H-naphtho[2,3-e]indazole is c1ccc2cc3c(ccc4[nH]ncc43)cc2c1.
What is the InChIKey of 3H-naphtho[2,3-e]indazole?
The InChIKey is BTQAFTBKHVLPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2/c1-2-4-11-8-13-12(7-10(11)3-1)5-6-15-14(13)9-16-17-15/h1-9H,(H,16,17).
What are the key properties of 3H-naphtho[2,3-e]indazole?
3H-naphtho[2,3-e]indazole has a molecular weight of 218.26 g/mol, XLogP of 3.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-naphtho[2,3-e]indazole is sourced from PubChem (CID 57355763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).