C18H22N6O4 — CID 57356489
1,2-dimethyl-7-[(2-methyl-4-nitrophenyl)diazenyl]-1,3-dihydroindazol-1-ium-6-amine acetate (PubChem CID 57356489) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1,2-dimethyl-7-[(2-methyl-4-nitrophenyl)diazenyl]-1,3-dihydroindazol-1-ium-6-amine acetate.
| Compound Name | 1,2-dimethyl-7-[(2-methyl-4-nitrophenyl)diazenyl]-1,3-dihydroindazol-1-ium-6-amine acetate |
|---|---|
| PubChem CID | 57356489 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1,2-dimethyl-7-[(2-methyl-4-nitrophenyl)diazenyl]-1,3-dihydroindazol-1-ium-6-amine acetate |
| SMILES | CC(=O)[O-].Cc1cc([N+](=O)[O-])ccc1/N=N/c1c(N)ccc2c1[NH+](C)N(C)C2 |
| InChI | InChI=1S/C16H18N6O2.C2H4O2/c1-10-8-12(22(23)24)5-7-14(10)18-19-15-13(17)6-4-11-9-20(2)21(3)16(11)15;1-2(3)4/h4-8H,9,17H2,1-3H3;1H3,(H,3,4)/b19-18+; |
| InChIKey | ZKIMAZPSYRDLJN-LTRPLHCISA-N |
| XLogP | 1.16 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|