C19H22N2O2 — CID 57356873
(2R)-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]pyrrolidine-2-carboxamide (PubChem CID 57356873) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2R)-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 57356873 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2R)-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)[C@H](O)c1ccccc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C19H22N2O2/c22-18(15-10-5-2-6-11-15)17(14-8-3-1-4-9-14)21-19(23)16-12-7-13-20-16/h1-6,8-11,16-18,20,22H,7,12-13H2,(H,21,23)/t16-,17-,18-/m1/s1 |
| InChIKey | JVOUIFUIIPEWLM-KZNAEPCWSA-N |
| XLogP | 2.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |