About (3,4-dimethyl-1,2-oxazol-5-yl)urea
(3,4-dimethyl-1,2-oxazol-5-yl)urea (PubChem CID 57357233) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is (3,4-dimethyl-1,2-oxazol-5-yl)urea.
Molecular Properties
| Compound Name | (3,4-dimethyl-1,2-oxazol-5-yl)urea |
| PubChem CID | 57357233 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (3,4-dimethyl-1,2-oxazol-5-yl)urea |
| SMILES | Cc1noc(NC(N)=O)c1C |
| InChI | InChI=1S/C6H9N3O2/c1-3-4(2)9-11-5(3)8-6(7)10/h1-2H3,(H3,7,8,10) |
| InChIKey | PIJAZECBFDYUPN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-dimethyl-1,2-oxazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethyl-1,2-oxazol-5-yl)urea?
The IUPAC name of (3,4-dimethyl-1,2-oxazol-5-yl)urea (CID 57357233) is (3,4-dimethyl-1,2-oxazol-5-yl)urea.
What is the SMILES notation for (3,4-dimethyl-1,2-oxazol-5-yl)urea?
The canonical SMILES for (3,4-dimethyl-1,2-oxazol-5-yl)urea is Cc1noc(NC(N)=O)c1C.
What is the InChIKey of (3,4-dimethyl-1,2-oxazol-5-yl)urea?
The InChIKey is PIJAZECBFDYUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-3-4(2)9-11-5(3)8-6(7)10/h1-2H3,(H3,7,8,10).
What are the key properties of (3,4-dimethyl-1,2-oxazol-5-yl)urea?
(3,4-dimethyl-1,2-oxazol-5-yl)urea has a molecular weight of 155.16 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethyl-1,2-oxazol-5-yl)urea is sourced from PubChem (CID 57357233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).