bis(3-methylbutan-1-amine);sulfuric acid

C10H28N2O4S — CID 57357267

IUPACbis(3-methylbutan-1-amine);sulfuric acid
SMILESCC(C)CCN.CC(C)CCN.O=S(=O)(O)O
InChIInChI=1S/2C5H13N.H2O4S/c2*1-5(2)3-4-6;1-5(2,3)4/h2*5H,3-4,6H2,1-2H3;(H2,1,2,3,4)
InChIKeyBHIHPZFEQAQAFU-UHFFFAOYSA-N
MW272.41 g/mol
LogP1.33
Rot. Bonds4

About bis(3-methylbutan-1-amine);sulfuric acid

bis(3-methylbutan-1-amine);sulfuric acid (PubChem CID 57357267) has the molecular formula C10H28N2O4S and a molecular weight of 272.41 g/mol. Its IUPAC name is bis(3-methylbutan-1-amine);sulfuric acid.

Molecular Properties

Compound Namebis(3-methylbutan-1-amine);sulfuric acid
PubChem CID57357267
Molecular FormulaC10H28N2O4S
Molecular Weight272.41 g/mol
Exact Mass272.18
IUPAC Namebis(3-methylbutan-1-amine);sulfuric acid
SMILESCC(C)CCN.CC(C)CCN.O=S(=O)(O)O
InChIInChI=1S/2C5H13N.H2O4S/c2*1-5(2)3-4-6;1-5(2,3)4/h2*5H,3-4,6H2,1-2H3;(H2,1,2,3,4)
InChIKeyBHIHPZFEQAQAFU-UHFFFAOYSA-N
XLogP1.33
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.41
LogP ≤ 51.33
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze bis(3-methylbutan-1-amine);sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(3-methylbutan-1-amine);sulfuric acid?
The IUPAC name of bis(3-methylbutan-1-amine);sulfuric acid (CID 57357267) is bis(3-methylbutan-1-amine);sulfuric acid.
What is the SMILES notation for bis(3-methylbutan-1-amine);sulfuric acid?
The canonical SMILES for bis(3-methylbutan-1-amine);sulfuric acid is CC(C)CCN.CC(C)CCN.O=S(=O)(O)O.
What is the InChIKey of bis(3-methylbutan-1-amine);sulfuric acid?
The InChIKey is BHIHPZFEQAQAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H13N.H2O4S/c2*1-5(2)3-4-6;1-5(2,3)4/h2*5H,3-4,6H2,1-2H3;(H2,1,2,3,4).
What are the key properties of bis(3-methylbutan-1-amine);sulfuric acid?
bis(3-methylbutan-1-amine);sulfuric acid has a molecular weight of 272.41 g/mol, XLogP of 1.33, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylbutan-1-amine);sulfuric acid is sourced from PubChem (CID 57357267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).