About 3H-[1,4]dioxino[2,3-e]benzimidazole
3H-[1,4]dioxino[2,3-e]benzimidazole (PubChem CID 57357367) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 3H-[1,4]dioxino[2,3-e]benzimidazole.
Molecular Properties
| Compound Name | 3H-[1,4]dioxino[2,3-e]benzimidazole |
| PubChem CID | 57357367 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 3H-[1,4]dioxino[2,3-e]benzimidazole |
| SMILES | C1=COc2c(ccc3[nH]cnc23)O1 |
| InChI | InChI=1S/C9H6N2O2/c1-2-7-9(13-4-3-12-7)8-6(1)10-5-11-8/h1-5H,(H,10,11) |
| InChIKey | SLDFOURMKCIXTG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-[1,4]dioxino[2,3-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-[1,4]dioxino[2,3-e]benzimidazole?
The IUPAC name of 3H-[1,4]dioxino[2,3-e]benzimidazole (CID 57357367) is 3H-[1,4]dioxino[2,3-e]benzimidazole.
What is the SMILES notation for 3H-[1,4]dioxino[2,3-e]benzimidazole?
The canonical SMILES for 3H-[1,4]dioxino[2,3-e]benzimidazole is C1=COc2c(ccc3[nH]cnc23)O1.
What is the InChIKey of 3H-[1,4]dioxino[2,3-e]benzimidazole?
The InChIKey is SLDFOURMKCIXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c1-2-7-9(13-4-3-12-7)8-6(1)10-5-11-8/h1-5H,(H,10,11).
What are the key properties of 3H-[1,4]dioxino[2,3-e]benzimidazole?
3H-[1,4]dioxino[2,3-e]benzimidazole has a molecular weight of 174.16 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-[1,4]dioxino[2,3-e]benzimidazole is sourced from PubChem (CID 57357367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).