dihydrazinylphosphinothious acid

H7N4PS — CID 57357548

IUPACdihydrazinylphosphinothious acid
SMILESNNP(S)NN
InChIInChI=1S/H7N4PS/c1-3-5(6)4-2/h3-4,6H,1-2H2
InChIKeyLXXPOIRNCACVID-UHFFFAOYSA-N
MW126.13 g/mol
LogP-0.93
Rot. Bonds2

About dihydrazinylphosphinothious acid

dihydrazinylphosphinothious acid (PubChem CID 57357548) has the molecular formula H7N4PS and a molecular weight of 126.13 g/mol. Its IUPAC name is dihydrazinylphosphinothious acid.

Molecular Properties

Compound Namedihydrazinylphosphinothious acid
PubChem CID57357548
Molecular FormulaH7N4PS
Molecular Weight126.13 g/mol
Exact Mass126.01
IUPAC Namedihydrazinylphosphinothious acid
SMILESNNP(S)NN
InChIInChI=1S/H7N4PS/c1-3-5(6)4-2/h3-4,6H,1-2H2
InChIKeyLXXPOIRNCACVID-UHFFFAOYSA-N
XLogP-0.93
TPSA76.10 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.13
LogP ≤ 5-0.93
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze dihydrazinylphosphinothious acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dihydrazinylphosphinothious acid?
The IUPAC name of dihydrazinylphosphinothious acid (CID 57357548) is dihydrazinylphosphinothious acid.
What is the SMILES notation for dihydrazinylphosphinothious acid?
The canonical SMILES for dihydrazinylphosphinothious acid is NNP(S)NN.
What is the InChIKey of dihydrazinylphosphinothious acid?
The InChIKey is LXXPOIRNCACVID-UHFFFAOYSA-N. The full InChI is InChI=1S/H7N4PS/c1-3-5(6)4-2/h3-4,6H,1-2H2.
What are the key properties of dihydrazinylphosphinothious acid?
dihydrazinylphosphinothious acid has a molecular weight of 126.13 g/mol, XLogP of -0.93, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrazinylphosphinothious acid is sourced from PubChem (CID 57357548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).