About cyclopent-3-ene-1,1-dicarbaldehyde
cyclopent-3-ene-1,1-dicarbaldehyde (PubChem CID 57357760) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is cyclopent-3-ene-1,1-dicarbaldehyde.
Molecular Properties
| Compound Name | cyclopent-3-ene-1,1-dicarbaldehyde |
| PubChem CID | 57357760 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | cyclopent-3-ene-1,1-dicarbaldehyde |
| SMILES | O=CC1(C=O)CC=CC1 |
| InChI | InChI=1S/C7H8O2/c8-5-7(6-9)3-1-2-4-7/h1-2,5-6H,3-4H2 |
| InChIKey | AFDFAQPAKALBSH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopent-3-ene-1,1-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-3-ene-1,1-dicarbaldehyde?
The IUPAC name of cyclopent-3-ene-1,1-dicarbaldehyde (CID 57357760) is cyclopent-3-ene-1,1-dicarbaldehyde.
What is the SMILES notation for cyclopent-3-ene-1,1-dicarbaldehyde?
The canonical SMILES for cyclopent-3-ene-1,1-dicarbaldehyde is O=CC1(C=O)CC=CC1.
What is the InChIKey of cyclopent-3-ene-1,1-dicarbaldehyde?
The InChIKey is AFDFAQPAKALBSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c8-5-7(6-9)3-1-2-4-7/h1-2,5-6H,3-4H2.
What are the key properties of cyclopent-3-ene-1,1-dicarbaldehyde?
cyclopent-3-ene-1,1-dicarbaldehyde has a molecular weight of 124.14 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-3-ene-1,1-dicarbaldehyde is sourced from PubChem (CID 57357760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).