About [1]benzofuro[7,6-h]chromen-8-one
[1]benzofuro[7,6-h]chromen-8-one (PubChem CID 57357836) has the molecular formula C15H8O3
and a molecular weight of 236.23 g/mol. Its IUPAC name is [1]benzofuro[7,6-h]chromen-8-one.
Molecular Properties
| Compound Name | [1]benzofuro[7,6-h]chromen-8-one |
| PubChem CID | 57357836 |
| Molecular Formula | C15H8O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | [1]benzofuro[7,6-h]chromen-8-one |
| SMILES | O=c1ccc2ccc3c(ccc4ccoc43)c2o1 |
| InChI | InChI=1S/C15H8O3/c16-13-6-3-9-1-4-11-12(15(9)18-13)5-2-10-7-8-17-14(10)11/h1-8H |
| InChIKey | APZLTTDPQKUMCY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze [1]benzofuro[7,6-h]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[7,6-h]chromen-8-one?
The IUPAC name of [1]benzofuro[7,6-h]chromen-8-one (CID 57357836) is [1]benzofuro[7,6-h]chromen-8-one.
What is the SMILES notation for [1]benzofuro[7,6-h]chromen-8-one?
The canonical SMILES for [1]benzofuro[7,6-h]chromen-8-one is O=c1ccc2ccc3c(ccc4ccoc43)c2o1.
What is the InChIKey of [1]benzofuro[7,6-h]chromen-8-one?
The InChIKey is APZLTTDPQKUMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O3/c16-13-6-3-9-1-4-11-12(15(9)18-13)5-2-10-7-8-17-14(10)11/h1-8H.
What are the key properties of [1]benzofuro[7,6-h]chromen-8-one?
[1]benzofuro[7,6-h]chromen-8-one has a molecular weight of 236.23 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[7,6-h]chromen-8-one is sourced from PubChem (CID 57357836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).