C18H22INO2 — CID 57357926
(1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid (PubChem CID 57357926) has the molecular formula C18H22INO2 and a molecular weight of 411.28 g/mol. Its IUPAC name is (1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid.
| Compound Name | (1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 57357926 |
| Molecular Formula | C18H22INO2 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (1R,2S,3S,5S)-8-(3-iodoprop-2-enyl)-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
| SMILES | Cc1ccc([C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)O)N3CC=CI)cc1 |
| InChI | InChI=1S/C18H22INO2/c1-12-3-5-13(6-4-12)15-11-14-7-8-16(17(15)18(21)22)20(14)10-2-9-19/h2-6,9,14-17H,7-8,10-11H2,1H3,(H,21,22)/t14-,15+,16+,17-/m0/s1 |
| InChIKey | XVDZDVGZYIHARA-HZMVEIRTSA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|