About 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene
3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene (PubChem CID 57357963) has the molecular formula C12H18S2
and a molecular weight of 226.41 g/mol. Its IUPAC name is 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene.
Molecular Properties
| Compound Name | 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene |
| PubChem CID | 57357963 |
| Molecular Formula | C12H18S2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene |
| SMILES | C=CC(C=CC)SSC(C=C)C=CC |
| InChI | InChI=1S/C12H18S2/c1-5-9-11(7-3)13-14-12(8-4)10-6-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | TVGODXIWIVIPIJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene?
The IUPAC name of 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene (CID 57357963) is 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene.
What is the SMILES notation for 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene?
The canonical SMILES for 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene is C=CC(C=CC)SSC(C=C)C=CC.
What is the InChIKey of 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene?
The InChIKey is TVGODXIWIVIPIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18S2/c1-5-9-11(7-3)13-14-12(8-4)10-6-2/h5-12H,3-4H2,1-2H3.
What are the key properties of 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene?
3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene has a molecular weight of 226.41 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hexa-1,4-dien-3-yldisulfanyl)hexa-1,4-diene is sourced from PubChem (CID 57357963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).