C17H9N9O12 — CID 57358033
6-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine (PubChem CID 57358033) has the molecular formula C17H9N9O12 and a molecular weight of 531.31 g/mol. Its IUPAC name is 6-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine.
| Compound Name | 6-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 57358033 |
| Molecular Formula | C17H9N9O12 |
| Molecular Weight | 531.31 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 6-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine |
| SMILES | Nc1cccc(N(c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C17H9N9O12/c18-14-2-1-3-15(19-14)20(16-10(23(31)32)4-8(21(27)28)5-11(16)24(33)34)17-12(25(35)36)6-9(22(29)30)7-13(17)26(37)38/h1-7H,(H2,18,19) |
| InChIKey | JZXYVSQHRSBWOD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 300.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|