acetic acid;2-methylnaphthalene-1,4-diol

C13H14O4 — CID 57358360

IUPACacetic acid;2-methylnaphthalene-1,4-diol
SMILESCC(=O)O.Cc1cc(O)c2ccccc2c1O
InChIInChI=1S/C11H10O2.C2H4O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13;1-2(3)4/h2-6,12-13H,1H3;1H3,(H,3,4)
InChIKeyHXCMGUXRBKICAV-UHFFFAOYSA-N
MW234.25 g/mol
LogP2.65
Rot. Bonds

About acetic acid;2-methylnaphthalene-1,4-diol

acetic acid;2-methylnaphthalene-1,4-diol (PubChem CID 57358360) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is acetic acid;2-methylnaphthalene-1,4-diol.

Molecular Properties

Compound Nameacetic acid;2-methylnaphthalene-1,4-diol
PubChem CID57358360
Molecular FormulaC13H14O4
Molecular Weight234.25 g/mol
Exact Mass234.09
IUPAC Nameacetic acid;2-methylnaphthalene-1,4-diol
SMILESCC(=O)O.Cc1cc(O)c2ccccc2c1O
InChIInChI=1S/C11H10O2.C2H4O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13;1-2(3)4/h2-6,12-13H,1H3;1H3,(H,3,4)
InChIKeyHXCMGUXRBKICAV-UHFFFAOYSA-N
XLogP2.65
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 52.65
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze acetic acid;2-methylnaphthalene-1,4-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-methylnaphthalene-1,4-diol?
The IUPAC name of acetic acid;2-methylnaphthalene-1,4-diol (CID 57358360) is acetic acid;2-methylnaphthalene-1,4-diol.
What is the SMILES notation for acetic acid;2-methylnaphthalene-1,4-diol?
The canonical SMILES for acetic acid;2-methylnaphthalene-1,4-diol is CC(=O)O.Cc1cc(O)c2ccccc2c1O.
What is the InChIKey of acetic acid;2-methylnaphthalene-1,4-diol?
The InChIKey is HXCMGUXRBKICAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2.C2H4O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13;1-2(3)4/h2-6,12-13H,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methylnaphthalene-1,4-diol?
acetic acid;2-methylnaphthalene-1,4-diol has a molecular weight of 234.25 g/mol, XLogP of 2.65, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methylnaphthalene-1,4-diol is sourced from PubChem (CID 57358360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).