About 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol
1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol (PubChem CID 57358466) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol.
Molecular Properties
| Compound Name | 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol |
| PubChem CID | 57358466 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol |
| SMILES | C=c1ccccc1=C(C)O |
| InChI | InChI=1S/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6,10H,1H2,2H3 |
| InChIKey | JOOXKAJAHXLBNC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol?
The IUPAC name of 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol (CID 57358466) is 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol.
What is the SMILES notation for 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol?
The canonical SMILES for 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol is C=c1ccccc1=C(C)O.
What is the InChIKey of 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol?
The InChIKey is JOOXKAJAHXLBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6,10H,1H2,2H3.
What are the key properties of 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol?
1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol has a molecular weight of 134.18 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethanol is sourced from PubChem (CID 57358466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).