About bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate
bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate (PubChem CID 57358513) has the molecular formula C30H36N6O4S
and a molecular weight of 576.72 g/mol. Its IUPAC name is bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate.
Molecular Properties
| Compound Name | bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate |
| PubChem CID | 57358513 |
| Molecular Formula | C30H36N6O4S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate |
| SMILES | Cc1cc(C=NN(C)c2ccccc2)cc[n+]1C.Cc1cc(C=NN(C)c2ccccc2)cc[n+]1C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C15H18N3.H2O4S/c2*1-13-11-14(9-10-17(13)2)12-16-18(3)15-7-5-4-6-8-15;1-5(2,3)4/h2*4-12H,1-3H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | WPWSHSMNNPCBQL-UHFFFAOYSA-L |
| XLogP | 3.24 |
| TPSA | 119.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate?
The IUPAC name of bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate (CID 57358513) is bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate.
What is the SMILES notation for bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate?
The canonical SMILES for bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate is Cc1cc(C=NN(C)c2ccccc2)cc[n+]1C.Cc1cc(C=NN(C)c2ccccc2)cc[n+]1C.O=S(=O)([O-])[O-].
What is the InChIKey of bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate?
The InChIKey is WPWSHSMNNPCBQL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C15H18N3.H2O4S/c2*1-13-11-14(9-10-17(13)2)12-16-18(3)15-7-5-4-6-8-15;1-5(2,3)4/h2*4-12H,1-3H3;(H2,1,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate?
bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate has a molecular weight of 576.72 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-[(1,2-dimethylpyridin-1-ium-4-yl)methylideneamino]-N-methylaniline);sulfate is sourced from PubChem (CID 57358513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).