About 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene
7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene (PubChem CID 57358712) has the molecular formula C7H4N2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene.
Analyze 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene?
The IUPAC name of 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene (CID 57358712) is 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene.
What is the SMILES notation for 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene?
The canonical SMILES for 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene is c1nc2c3cc-3cc2[nH]1.
What is the InChIKey of 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene?
The InChIKey is ZNQFXBINCVPRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2/c1-4-2-6-7(5(1)4)9-3-8-6/h1-3H,(H,8,9).
What are the key properties of 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene?
7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene has a molecular weight of 116.12 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraene is sourced from PubChem (CID 57358712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).