C56H72N6O8S — CID 57358819
bis([4-[[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium);sulfate (PubChem CID 57358819) has the molecular formula C56H72N6O8S and a molecular weight of 989.29 g/mol. Its IUPAC name is bis([4-[[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium);sulfate.
| Compound Name | bis([4-[[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium);sulfate |
|---|---|
| PubChem CID | 57358819 |
| Molecular Formula | C56H72N6O8S |
| Molecular Weight | 989.29 g/mol |
| Exact Mass | 988.51 |
| IUPAC Name | bis([4-[[5-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium);sulfate |
| SMILES | Cc1ccc(N(CCO)CCO)cc1C(=C1C=CC(=[N+](C)C)C=C1)c1ccc(N(C)C)cc1.Cc1ccc(N(CCO)CCO)cc1C(=C1C=CC(=[N+](C)C)C=C1)c1ccc(N(C)C)cc1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C28H36N3O2.H2O4S/c2*1-21-6-11-26(31(16-18-32)17-19-33)20-27(21)28(22-7-12-24(13-8-22)29(2)3)23-9-14-25(15-10-23)30(4)5;1-5(2,3)4/h2*6-15,20,32-33H,16-19H2,1-5H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | FXWOGNUMNUXFRM-UHFFFAOYSA-L |
| XLogP | 5.65 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.29 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|