About 2-nitrohexa-2,4-dien-1-ol
2-nitrohexa-2,4-dien-1-ol (PubChem CID 57359141) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-nitrohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 2-nitrohexa-2,4-dien-1-ol |
| PubChem CID | 57359141 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2-nitrohexa-2,4-dien-1-ol |
| SMILES | CC=CC=C(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C6H9NO3/c1-2-3-4-6(5-8)7(9)10/h2-4,8H,5H2,1H3 |
| InChIKey | RUKOUZUVIBPUBG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrohexa-2,4-dien-1-ol?
The IUPAC name of 2-nitrohexa-2,4-dien-1-ol (CID 57359141) is 2-nitrohexa-2,4-dien-1-ol.
What is the SMILES notation for 2-nitrohexa-2,4-dien-1-ol?
The canonical SMILES for 2-nitrohexa-2,4-dien-1-ol is CC=CC=C(CO)[N+](=O)[O-].
What is the InChIKey of 2-nitrohexa-2,4-dien-1-ol?
The InChIKey is RUKOUZUVIBPUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-3-4-6(5-8)7(9)10/h2-4,8H,5H2,1H3.
What are the key properties of 2-nitrohexa-2,4-dien-1-ol?
2-nitrohexa-2,4-dien-1-ol has a molecular weight of 143.14 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrohexa-2,4-dien-1-ol is sourced from PubChem (CID 57359141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).