About S-phenyl N-methylcarbamothioate
S-phenyl N-methylcarbamothioate (PubChem CID 573594) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is S-phenyl N-methylcarbamothioate.
Molecular Properties
| Compound Name | S-phenyl N-methylcarbamothioate |
| PubChem CID | 573594 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | S-phenyl N-methylcarbamothioate |
| SMILES | CNC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C8H9NOS/c1-9-8(10)11-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10) |
| InChIKey | NPQONXIVTPCTNX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl N-methylcarbamothioate?
The IUPAC name of S-phenyl N-methylcarbamothioate (CID 573594) is S-phenyl N-methylcarbamothioate.
What is the SMILES notation for S-phenyl N-methylcarbamothioate?
The canonical SMILES for S-phenyl N-methylcarbamothioate is CNC(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl N-methylcarbamothioate?
The InChIKey is NPQONXIVTPCTNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS/c1-9-8(10)11-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10).
What are the key properties of S-phenyl N-methylcarbamothioate?
S-phenyl N-methylcarbamothioate has a molecular weight of 167.23 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl N-methylcarbamothioate is sourced from PubChem (CID 573594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).