C15H26O5Si — CID 57360713
2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]butanoic acid (PubChem CID 57360713) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]butanoic acid.
| Compound Name | 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 57360713 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[(4R,4aR,6S,8aS)-6-ethoxy-2,2-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[2,3-e]oxasilin-4-yl]butanoic acid |
| SMILES | CCO[C@@H]1C=C[C@@H]2O[Si](C)(C)C[C@H](C(CC)C(=O)O)[C@H]2O1 |
| InChI | InChI=1S/C15H26O5Si/c1-5-10(15(16)17)11-9-21(3,4)20-12-7-8-13(18-6-2)19-14(11)12/h7-8,10-14H,5-6,9H2,1-4H3,(H,16,17)/t10?,11-,12+,13+,14-/m1/s1 |
| InChIKey | WWTYNTINRPGAIV-HOXDRQDXSA-N |
| XLogP | 2.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|