About 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride
3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride (PubChem CID 57361593) has the molecular formula C9H11Cl3N2O
and a molecular weight of 269.56 g/mol. Its IUPAC name is 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride.
Molecular Properties
| Compound Name | 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride |
| PubChem CID | 57361593 |
| Molecular Formula | C9H11Cl3N2O |
| Molecular Weight | 269.56 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride |
| SMILES | Cc1cccc(N)[n+]1CC(=O)C(Cl)Cl.[Cl-] |
| InChI | InChI=1S/C9H10Cl2N2O.ClH/c1-6-3-2-4-8(12)13(6)5-7(14)9(10)11;/h2-4,9,12H,5H2,1H3;1H |
| InChIKey | OAGWNPDXPQNYSO-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.56 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride?
The IUPAC name of 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride (CID 57361593) is 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride.
What is the SMILES notation for 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride?
The canonical SMILES for 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride is Cc1cccc(N)[n+]1CC(=O)C(Cl)Cl.[Cl-].
What is the InChIKey of 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride?
The InChIKey is OAGWNPDXPQNYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O.ClH/c1-6-3-2-4-8(12)13(6)5-7(14)9(10)11;/h2-4,9,12H,5H2,1H3;1H.
What are the key properties of 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride?
3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride has a molecular weight of 269.56 g/mol, XLogP of -1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-6-methylpyridin-1-ium-1-yl)-1,1-dichloropropan-2-one chloride is sourced from PubChem (CID 57361593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).