C19H20BClO4 — CID 57361678
benzyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate (PubChem CID 57361678) has the molecular formula C19H20BClO4 and a molecular weight of 358.63 g/mol. Its IUPAC name is benzyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate.
| Compound Name | benzyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate |
|---|---|
| PubChem CID | 57361678 |
| Molecular Formula | C19H20BClO4 |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | benzyl 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate |
| SMILES | CC1(C)COB(c2cc(Cl)ccc2C(=O)OCc2ccccc2)OC1 |
| InChI | InChI=1S/C19H20BClO4/c1-19(2)12-24-20(25-13-19)17-10-15(21)8-9-16(17)18(22)23-11-14-6-4-3-5-7-14/h3-10H,11-13H2,1-2H3 |
| InChIKey | FKYXDODCLSCDCI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|